chore: update crates, names and clippy fixes

This commit is contained in:
Jesús Pérez 2026-02-04 01:02:18 +00:00
parent 069c8785a9
commit fc1c699795
Signed by: jesus
GPG Key ID: 9F243E355E0BC939
54 changed files with 1635 additions and 1321 deletions

2
.gitignore vendored
View File

@ -1,5 +1,7 @@
.p .p
.claude .claude
.opencode
AGENTS.md
.vscode .vscode
.shellcheckrc .shellcheckrc
.coder .coder

9
.gitmodules vendored Normal file
View File

@ -0,0 +1,9 @@
[submodule "secretumvault"]
path = secretumvault
url = ssh://git@repo.jesusperez.pro:32225/jesus/secretumvault.git
[submodule "stratumiops"]
path = stratumiops
url = ssh://git@repo.jesusperez.pro:32225/jesus/stratumiops.git
[submodule "syntaxis"]
path = syntaxis
url = ssh://git@repo.jesusperez.pro:32225/jesus/syntaxis.git

View File

@ -9,11 +9,26 @@ members = [
"crates/control-center", "crates/control-center",
"crates/control-center-ui", "crates/control-center-ui",
"crates/vault-service", "crates/vault-service",
"crates/rag",
"crates/detector", "crates/detector",
"crates/mcp-server", "crates/mcp-server",
"crates/provisioning-daemon", "crates/daemon",
"prov-ecosystem/crates/daemon-cli",
"prov-ecosystem/crates/machines",
"prov-ecosystem/crates/encrypt",
"prov-ecosystem/crates/backup",
"prov-ecosystem/crates/observability",
] ]
exclude = [
"syntaxis",
"syntaxis/core",
"prov-ecosystem/crates/syntaxis-integration",
"prov-ecosystem/crates/audit",
"prov-ecosystem/crates/valida",
"prov-ecosystem/crates/runtime",
"prov-ecosystem/crates/gitops",
]
resolver = "2" resolver = "2"
[workspace.package] [workspace.package]
@ -39,7 +54,7 @@ resolver = "2"
serde = { version = "1.0", features = ["derive"] } serde = { version = "1.0", features = ["derive"] }
serde_json = "1.0" serde_json = "1.0"
toml = "0.9" toml = "0.9"
uuid = { version = "1.19", features = ["v4", "serde"] } uuid = { version = "1.20", features = ["v4", "serde"] }
# ============================================================================ # ============================================================================
# ERROR HANDLING # ERROR HANDLING
@ -80,7 +95,7 @@ resolver = "2"
# DATABASE AND STORAGE # DATABASE AND STORAGE
# ============================================================================ # ============================================================================
sqlx = { version = "0.8", features = ["runtime-tokio-rustls", "sqlite", "chrono", "uuid"] } sqlx = { version = "0.8", features = ["runtime-tokio-rustls", "sqlite", "chrono", "uuid"] }
surrealdb = { version = "2.4", features = ["kv-mem", "protocol-ws", "protocol-http"] } surrealdb = { version = "2.6", features = ["kv-mem", "protocol-ws", "protocol-http"] }
# ============================================================================ # ============================================================================
# SECURITY AND CRYPTOGRAPHY # SECURITY AND CRYPTOGRAPHY
@ -89,7 +104,7 @@ resolver = "2"
argon2 = "0.5" argon2 = "0.5"
base64 = "0.22" base64 = "0.22"
hmac = "0.12" hmac = "0.12"
jsonwebtoken = { version = "10.2", features = ["rust_crypto"] } jsonwebtoken = { version = "10.3", features = ["rust_crypto"] }
rand = { version = "0.9", features = ["std_rng", "os_rng"] } rand = { version = "0.9", features = ["std_rng", "os_rng"] }
ring = "0.17" ring = "0.17"
sha2 = "0.10" sha2 = "0.10"
@ -127,7 +142,7 @@ resolver = "2"
# Additional cryptography # Additional cryptography
hkdf = "0.12" hkdf = "0.12"
rsa = "0.9.9" rsa = "0.9.10"
zeroize = { version = "1.8", features = ["derive"] } zeroize = { version = "1.8", features = ["derive"] }
# Additional security # Additional security
@ -186,7 +201,7 @@ resolver = "2"
wasm-bindgen-futures = "0.4" wasm-bindgen-futures = "0.4"
# Random number generation # Random number generation
getrandom = { version = "0.3" } getrandom = { version = "0.4" }
# ============================================================================ # ============================================================================
# TUI (Terminal User Interface) # TUI (Terminal User Interface)
@ -216,28 +231,164 @@ resolver = "2"
parking_lot = "0.12" parking_lot = "0.12"
which = "8" which = "8"
yaml-rust = "0.4" yaml-rust = "0.4"
humantime-serde = "1.1"
# Metrics
prometheus = "0.14"
approx = "0.5"
# Utilities
xxhash-rust = { version = "0.8", features = ["xxh3"] }
# ============================================================================ # ============================================================================
# RAG FRAMEWORK DEPENDENCIES (Rig) # RAG FRAMEWORK DEPENDENCIES (Rig)
# ============================================================================ # ============================================================================
rig-core = "0.27" rig-core = "0.30"
rig-surrealdb = "0.1" rig-surrealdb = "0.1"
tokenizers = "0.22" tokenizers = "0.22"
# ============================================================================ # ============================================================================
# PROV-ECOSYSTEM DAEMON (replaces cli-daemon) # STRATUM ECOSYSTEM DEPENDENCIES (for RAG embeddings & LLM)
# ============================================================================ # ============================================================================
daemon-cli = { path = "../../submodules/prov-ecosystem/crates/daemon-cli" } moka = { version = "0.12", features = ["future"] }
sled = "0.34"
fastembed = "5.8"
lancedb = "0.23"
arrow = "=56"
# ============================================================================ # ============================================================================
# SECRETUMVAULT (Enterprise Secrets Management) # INTERNAL WORKSPACE CRATES (Local path dependencies)
# ============================================================================ # ============================================================================
secretumvault = { path = "../../submodules/secretumvault" } platform-config = { path = "./crates/platform-config" }
service-clients = { path = "./crates/service-clients" }
rag = { path = "./crates/rag" }
mcp-server = { path = "./crates/mcp-server" }
ai-service = { path = "./crates/ai-service" }
# ============================================================================
# PROV-ECOSYSTEM (Now members of workspace)
# ============================================================================
daemon-cli = { path = "./prov-ecosystem/crates/daemon-cli" }
machines = { path = "./prov-ecosystem/crates/machines" }
encrypt = { path = "./prov-ecosystem/crates/encrypt" }
backup = { path = "./prov-ecosystem/crates/backup" }
observability = { path = "./prov-ecosystem/crates/observability" }
init-servs = { path = "./prov-ecosystem/crates/init-servs" }
# stratum-embeddings and stratum-llm are built in isolated Docker context for RAG
# See: crates/rag/docker/Dockerfile
stratum-embeddings = { path = "./stratumiops/crates/stratum-embeddings", features = ["openai-provider", "ollama-provider", "fastembed-provider", "memory-cache"] }
stratum-llm = { path = "./stratumiops/crates/stratum-llm", features = ["anthropic", "openai", "ollama"] }
# ============================================================================
# SECRETUMVAULT (Enterprise Secrets Management - optional)
# ============================================================================
secretumvault = { path = "./secretumvault" }
# ============================================================================
# WASM/WEB-SPECIFIC DEPENDENCIES
# ============================================================================
web-sys = { version = "0.3", features = [
"console",
"Window",
"Document",
"Element",
"HtmlElement",
"HtmlCanvasElement",
"CanvasRenderingContext2d",
"EventTarget",
"Event",
"DragEvent",
"DataTransfer",
"HtmlInputElement",
"HtmlSelectElement",
"HtmlTextAreaElement",
"HtmlButtonElement",
"HtmlDivElement",
"Storage",
"Location",
"History",
"Navigator",
"ServiceWorkerRegistration",
"ServiceWorker",
"NotificationPermission",
"Notification",
"Headers",
"Request",
"RequestInit",
"RequestMode",
"Response",
"AbortController",
"AbortSignal",
"WebSocket",
"MessageEvent",
"CloseEvent",
"ErrorEvent",
"Blob",
"Url",
"FileReader",
"File",
"HtmlAnchorElement",
"MouseEvent",
"TouchEvent",
"KeyboardEvent",
"ResizeObserver",
"ResizeObserverEntry",
"IntersectionObserver",
"IntersectionObserverEntry",
"MediaQueryList",
"MediaQueryListEvent",
"CredentialsContainer",
"PublicKeyCredential",
"PublicKeyCredentialCreationOptions",
"PublicKeyCredentialRequestOptions",
"AuthenticatorResponse",
"AuthenticatorAttestationResponse",
"AuthenticatorAssertionResponse",
"Crypto",
"SubtleCrypto",
"CryptoKey",
] }
# ============================================================================
# ADDITIONAL MISSING DEPENDENCIES (Not in original workspace)
# ============================================================================
ed25519-dalek = "2.2"
http-body-util = "0.1"
# ============================================================================ # ============================================================================
# BYTES MANIPULATION # BYTES MANIPULATION
# ============================================================================ # ============================================================================
bytes = "1.5" bytes = "1.11"
# ============================================================================
# HTTP AND PROTOCOL UTILITIES
# ============================================================================
http = "1"
# ============================================================================
# CONTAINER MANAGEMENT AND SSH
# ============================================================================
bollard = "0.20"
russh = "0.57"
russh-keys = "0.49"
# ============================================================================
# SECRETS MANAGEMENT
# ============================================================================
age = "0.11"
rusty_vault = "0.2.1"
# ============================================================================
# ADDITIONAL DATA FORMAT SERIALIZATION
# ============================================================================
serde_yaml = "0.9"
# ============================================================================
# PATH AND SHELL UTILITIES
# ============================================================================
shellexpand = "3.1"
[workspace.metadata] [workspace.metadata]
description = "Provisioning Platform - Rust workspace for cloud infrastructure automation tools" description = "Provisioning Platform - Rust workspace for cloud infrastructure automation tools"

View File

@ -5,6 +5,10 @@ edition.workspace = true
name = "ai-service" name = "ai-service"
version.workspace = true version.workspace = true
[[bin]]
name = "provisioning-ai-service"
path = "src/main.rs"
[dependencies] [dependencies]
# Workspace dependencies # Workspace dependencies
async-trait = { workspace = true } async-trait = { workspace = true }
@ -22,7 +26,7 @@ serde_json = { workspace = true }
toml = { workspace = true } toml = { workspace = true }
# Platform configuration # Platform configuration
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Error handling # Error handling
anyhow = { workspace = true } anyhow = { workspace = true }
@ -40,14 +44,18 @@ uuid = { workspace = true, features = ["v4", "serde"] }
clap = { workspace = true, features = ["derive"] } clap = { workspace = true, features = ["derive"] }
# RAG crate for AI capabilities # RAG crate for AI capabilities
provisioning-rag = { path = "../rag" } rag = { workspace = true }
# MCP server tools for real implementations # MCP server tools for real implementations
provisioning-mcp-server = { path = "../mcp-server" } mcp-server = { workspace = true }
# Graph operations for DAG # Graph operations for DAG
petgraph = { workspace = true } petgraph = { workspace = true }
# Stratum ecosystem - embeddings and LLM abstraction (optional - requires external setup)
stratum-embeddings = { workspace = true }
stratum-llm = { workspace = true }
[dev-dependencies] [dev-dependencies]
tempfile = { workspace = true } tempfile = { workspace = true }
tokio-test = { workspace = true } tokio-test = { workspace = true }
@ -56,8 +64,3 @@ tokio-test = { workspace = true }
[lib] [lib]
name = "ai_service" name = "ai_service"
path = "src/lib.rs" path = "src/lib.rs"
# Binary target
[[bin]]
name = "ai-service"
path = "src/main.rs"

View File

@ -13,12 +13,24 @@ use tracing_subscriber::{layer::SubscriberExt, util::SubscriberInitExt};
#[command(name = "ai-service")] #[command(name = "ai-service")]
#[command(about = "HTTP service for AI capabilities including RAG, MCP tool invocation, DAG operations, and knowledge graphs", long_about = None)] #[command(about = "HTTP service for AI capabilities including RAG, MCP tool invocation, DAG operations, and knowledge graphs", long_about = None)]
struct Args { struct Args {
/// Configuration file path (highest priority)
#[arg(short = 'c', long, env = "AI_SERVICE_CONFIG")]
config: Option<std::path::PathBuf>,
/// Configuration directory (searches for ai-service.ncl|toml|json)
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
config_dir: Option<std::path::PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
#[arg(short = 'm', long, env = "AI_SERVICE_MODE")]
mode: Option<String>,
/// Service bind address /// Service bind address
#[arg(short, long, default_value = "127.0.0.1")] #[arg(short = 'H', long, default_value = "127.0.0.1")]
host: String, host: String,
/// Service bind port /// Service bind port
#[arg(short, long, default_value_t = DEFAULT_PORT)] #[arg(short = 'p', long, default_value_t = DEFAULT_PORT)]
port: u16, port: u16,
} }

View File

@ -1,9 +1,11 @@
[package] [package]
authors = ["Control Center Team"] authors.workspace = true
autobins = false # Disable auto-detection of binary targets autobins = false
description = "Control Center UI - Leptos CSR App for Cloud Infrastructure Management" description = "Control Center UI - Leptos CSR App for Cloud Infrastructure Management"
edition.workspace = true edition.workspace = true
license.workspace = true
name = "control-center-ui" name = "control-center-ui"
repository.workspace = true
version.workspace = true version.workspace = true
[lib] [lib]
@ -87,89 +89,21 @@ js-sys = { workspace = true }
wasm-bindgen-futures = { workspace = true } wasm-bindgen-futures = { workspace = true }
# Random number generation (WASM-specific override with js feature) # Random number generation (WASM-specific override with js feature)
getrandom = { version = "0.3.4", features = ["wasm_js"] } getrandom = { workspace = true, features = ["wasm_js"] }
# ============================================================================ # HTTP client
# PROJECT-SPECIFIC DEPENDENCIES (not in workspace) reqwest = { workspace = true, features = ["json"] }
# ============================================================================
# Web APIs # Tokio with time features
web-sys = { version = "0.3", features = [ tokio = { workspace = true, features = ["time"] }
"console",
"Window",
"Document",
"Element",
"HtmlElement",
"HtmlCanvasElement",
"CanvasRenderingContext2d",
"EventTarget",
"Event",
"DragEvent",
"DataTransfer",
"HtmlInputElement",
"HtmlSelectElement",
"HtmlTextAreaElement",
"HtmlButtonElement",
"HtmlDivElement",
"Storage",
"Location",
"History",
"Navigator",
"ServiceWorkerRegistration",
"ServiceWorker",
"NotificationPermission",
"Notification",
"Headers",
"Request",
"RequestInit",
"RequestMode",
"Response",
"AbortController",
"AbortSignal",
"WebSocket",
"MessageEvent",
"CloseEvent",
"ErrorEvent",
"Blob",
"Url",
"FileReader",
"File",
"HtmlAnchorElement",
"MouseEvent",
"TouchEvent",
"KeyboardEvent",
"ResizeObserver",
"ResizeObserverEntry",
"IntersectionObserver",
"IntersectionObserverEntry",
# Media Query APIs
"MediaQueryList",
"MediaQueryListEvent",
# WebAuthn APIs
"CredentialsContainer",
"PublicKeyCredential",
"PublicKeyCredentialCreationOptions",
"PublicKeyCredentialRequestOptions",
"AuthenticatorResponse",
"AuthenticatorAttestationResponse",
"AuthenticatorAssertionResponse",
# Crypto APIs
"Crypto",
"SubtleCrypto",
"CryptoKey",
] }
# HTTP client (project-specific for WASM features) # Web APIs (WASM browser APIs)
reqwest = { version = "0.13", features = ["json"] } web-sys = { workspace = true }
# Tokio with time features for WASM (project-specific version)
tokio = { version = "1.49", features = ["time"] }
# Profile configurations moved to workspace root # Profile configurations moved to workspace root
# WASM pack settings [package.metadata.wasm-pack.profile.release]
[package.metadata.wasm-pack.profile.release] wasm-opt = ['-Oz', '--enable-mutable-globals']
wasm-opt = ['-Oz', '--enable-mutable-globals']
[package.metadata.wasm-pack.profile.dev] [package.metadata.wasm-pack.profile.dev]
wasm-opt = false wasm-opt = false

View File

@ -52,10 +52,10 @@ validator = { workspace = true }
reqwest = { workspace = true } reqwest = { workspace = true }
# HTTP service clients (machines, init, AI) - enables remote service calls # HTTP service clients (machines, init, AI) - enables remote service calls
service-clients = { path = "../service-clients" } service-clients = { workspace = true }
# Platform configuration management # Platform configuration management
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Security and cryptography # Security and cryptography
aes-gcm = { workspace = true } aes-gcm = { workspace = true }
@ -153,9 +153,8 @@ compliance = ["core"]
# Modules: anomaly (detection) # Modules: anomaly (detection)
experimental = ["core"] experimental = ["core"]
# Default: Recommended for standard deployments # Default: All features enabled
# Includes auth, KMS, audit - the essentials default = ["core", "kms", "audit", "mfa", "compliance", "experimental"]
default = ["core", "kms", "audit"]
# Full: All features enabled (development and testing) # Full: All features enabled (development and testing)
all = ["core", "kms", "audit", "mfa", "compliance", "experimental"] all = ["core", "kms", "audit", "mfa", "compliance", "experimental"]
@ -165,8 +164,7 @@ all = ["core", "kms", "audit", "mfa", "compliance", "experimental"]
name = "control_center" name = "control_center"
path = "src/lib.rs" path = "src/lib.rs"
# Binary target (uses all features) # Binary target (uses all features by default)
[[bin]] [[bin]]
name = "control-center" name = "provisioning-control-center"
path = "src/main.rs" path = "src/main.rs"
required-features = ["all"]

View File

@ -1,65 +0,0 @@
# Multi-stage build for Control-Center
# Builds from platform workspace root
# Build stage - Using nightly for edition2024 support (required by async-graphql 7.x)
FROM rustlang/rust:nightly-bookworm AS builder
WORKDIR /workspace
# Install build dependencies
RUN apt-get update && apt-get install -y \
pkg-config \
libssl-dev \
&& rm -rf /var/lib/apt/lists/*
# Copy entire platform workspace (required for workspace dependencies)
COPY Cargo.toml Cargo.lock ./
COPY orchestrator ./orchestrator
COPY control-center ./control-center
COPY control-center-ui ./control-center-ui
COPY mcp-server ./mcp-server
COPY installer ./installer
# Build control-center (workspace-aware)
WORKDIR /workspace
RUN cargo build --release --package control-center
# Runtime stage
FROM debian:bookworm-slim
# Install runtime dependencies
RUN apt-get update && apt-get install -y \
ca-certificates \
curl \
&& rm -rf /var/lib/apt/lists/*
# Create non-root user
RUN useradd -m -u 1000 provisioning && \
mkdir -p /data /var/log/control-center && \
chown -R provisioning:provisioning /data /var/log/control-center
# Copy binary from builder
COPY --from=builder /workspace/target/release/control-center /usr/local/bin/control-center
RUN chmod +x /usr/local/bin/control-center
# Copy default configuration
COPY control-center/config.defaults.toml /etc/provisioning/config.defaults.toml
# Switch to non-root user
USER provisioning
WORKDIR /app
# Expose port
EXPOSE 8081
# Set environment variables
ENV RUST_LOG=info
ENV DATA_DIR=/data
ENV CONTROL_CENTER_DATABASE_URL=rocksdb:///data/control-center.db
# Health check
HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \
CMD curl -f http://localhost:8081/health || exit 1
# Run the binary with config path
CMD ["control-center", "--config", "/etc/provisioning/config.defaults.toml"]

View File

@ -47,13 +47,30 @@ use tracing_subscriber::EnvFilter;
#[command(name = "control-center")] #[command(name = "control-center")]
#[command(about = "Control Center - JWT Authentication & User Management Service")] #[command(about = "Control Center - JWT Authentication & User Management Service")]
#[command(version = env!("CARGO_PKG_VERSION"))] #[command(version = env!("CARGO_PKG_VERSION"))]
#[command(after_help = "CONFIGURATION HIERARCHY (highest to lowest priority):\n 1. CLI: -c/--config <path> (explicit file)\n 2. CLI: --config-dir <dir> --mode <mode> (directory + mode)\n 3. CLI: --config-dir <dir> (searches for control-center.ncl|toml|json)\n 4. CLI: --mode <mode> (searches in provisioning/platform/config/)\n 5. ENV: CONTROL_CENTER_CONFIG (explicit file)\n 6. ENV: PROVISIONING_CONFIG_DIR (searches for control-center.ncl|toml|json)\n 7. ENV: CONTROL_CENTER_MODE (mode-based in default path)\n 8. Built-in defaults")]
struct Cli { struct Cli {
/// Configuration file path /// Configuration file path (highest priority)
#[arg(short, long, default_value = "config.toml")] ///
/// Accepts absolute or relative path. Supports .ncl, .toml, and .json formats.
#[arg(short = 'c', long, env = "CONTROL_CENTER_CONFIG")]
config: Option<PathBuf>, config: Option<PathBuf>,
/// Configuration directory (searches for control-center.ncl|toml|json)
///
/// Searches for configuration files in order of preference: .ncl > .toml > .json
/// Can also search for mode-specific files: control-center.{mode}.{ncl|toml|json}
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
config_dir: Option<PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
///
/// Determines which configuration profile to use. Searches in:
/// provisioning/platform/config/control-center.{mode}.{ncl|toml}
#[arg(short = 'm', long, env = "CONTROL_CENTER_MODE")]
mode: Option<String>,
/// Server port (overrides config file) /// Server port (overrides config file)
#[arg(short, long)] #[arg(short = 'p', long)]
port: Option<u16>, port: Option<u16>,
/// Server host (overrides config file) /// Server host (overrides config file)
@ -90,9 +107,15 @@ async fn main() -> Result<()> {
.with_target(false) .with_target(false)
.init(); .init();
// Resolve config file path using new resolver
let resolver = platform_config::ConfigResolver::new()
.with_cli_config(cli.config.clone())
.with_cli_config_dir(cli.config_dir.clone())
.with_cli_mode(cli.mode.clone());
// Load configuration // Load configuration
let mut config = if let Some(config_path) = cli.config { let mut config = if let Some(path) = resolver.resolve("control-center") {
Config::load_from_file(config_path)? Config::load_from_file(path)?
} else { } else {
Config::load()? Config::load()?
}; };

View File

@ -2,10 +2,14 @@
authors.workspace = true authors.workspace = true
edition.workspace = true edition.workspace = true
license.workspace = true license.workspace = true
name = "provisioning-daemon" name = "daemon"
repository.workspace = true repository.workspace = true
version.workspace = true version.workspace = true
[[bin]]
name = "provisioning-daemon"
path = "src/main.rs"
[dependencies] [dependencies]
# Core daemon library from prov-ecosystem # Core daemon library from prov-ecosystem
daemon-cli = { workspace = true } daemon-cli = { workspace = true }
@ -22,7 +26,7 @@ serde_json = { workspace = true }
toml = { workspace = true } toml = { workspace = true }
# Platform configuration # Platform configuration
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Error handling # Error handling
anyhow = { workspace = true } anyhow = { workspace = true }

View File

@ -0,0 +1,38 @@
FROM debian:bookworm-slim
# Install runtime dependencies
RUN apt-get update && apt-get install -y \
ca-certificates \
curl \
&& rm -rf /var/lib/apt/lists/*
# Create user
RUN useradd -m -u 1000 provisioning && \
mkdir -p /data /var/log/provisioning-daemon /etc/provisioning && \
chown -R provisioning:provisioning /data /var/log/provisioning-daemon /etc/provisioning
# Copy pre-built binary
COPY target/release/provisioning-daemon /usr/local/bin/provisioning-daemon
RUN chmod +x /usr/local/bin/provisioning-daemon
# Copy default configuration files (assumes they're available at build time)
COPY provisioning/platform/config/runtime/generated/provisioning-daemon.*.toml /etc/provisioning/
USER provisioning
WORKDIR /app
EXPOSE 8079
ENV RUST_LOG=info
ENV DATA_DIR=/data
ENV PROVISIONING_DAEMON_MODE=solo
ENV PROVISIONING_CONFIG_DIR=/etc/provisioning
HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \
CMD curl -f http://localhost:8079/api/v1/health || exit 1
# Configuration precedence:
# 1. PROVISIONING_DAEMON_CONFIG (explicit path)
# 2. PROVISIONING_DAEMON_MODE (mode-specific file)
# 3. Default fallback
CMD ["provisioning-daemon"]

View File

@ -30,12 +30,20 @@ use tracing_subscriber::EnvFilter;
#[command(about = "Provisioning platform daemon with Nushell execution and config rendering")] #[command(about = "Provisioning platform daemon with Nushell execution and config rendering")]
#[command(version = env!("CARGO_PKG_VERSION"))] #[command(version = env!("CARGO_PKG_VERSION"))]
struct Args { struct Args {
/// Configuration file path /// Configuration file path (highest priority)
#[arg(short, long)] #[arg(short = 'c', long, env = "PROVISIONING_DAEMON_CONFIG")]
config: Option<PathBuf>, config: Option<PathBuf>,
/// Configuration directory (searches for provisioning-daemon.ncl|toml|json)
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
config_dir: Option<PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
#[arg(short = 'm', long, env = "PROVISIONING_DAEMON_MODE")]
mode: Option<String>,
/// Enable verbose logging /// Enable verbose logging
#[arg(short, long)] #[arg(short = 'v', long)]
verbose: bool, verbose: bool,
/// Validate configuration and exit /// Validate configuration and exit

View File

@ -5,6 +5,10 @@ edition.workspace = true
name = "extension-registry" name = "extension-registry"
version.workspace = true version.workspace = true
[[bin]]
name = "provisioning-extension-registry"
path = "src/main.rs"
[dependencies] [dependencies]
# Workspace dependencies # Workspace dependencies
async-trait = { workspace = true } async-trait = { workspace = true }
@ -21,7 +25,7 @@ serde = { workspace = true, features = ["derive"] }
serde_json = { workspace = true } serde_json = { workspace = true }
# Platform configuration # Platform configuration
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Error handling # Error handling
anyhow = { workspace = true } anyhow = { workspace = true }
@ -61,7 +65,7 @@ parking_lot = { workspace = true }
toml = { workspace = true } toml = { workspace = true }
[dev-dependencies] [dev-dependencies]
http-body-util = "0.1" http-body-util = { workspace = true }
hyper = { workspace = true } hyper = { workspace = true }
tempfile = { workspace = true } tempfile = { workspace = true }
tokio-test = { workspace = true } tokio-test = { workspace = true }
@ -70,8 +74,3 @@ tokio-test = { workspace = true }
[lib] [lib]
name = "extension_registry" name = "extension_registry"
path = "src/lib.rs" path = "src/lib.rs"
# Binary target
[[bin]]
name = "extension-registry"
path = "src/main.rs"

View File

@ -1,7 +1,34 @@
# Build stage # Multi-stage build for extension-registry
FROM rust:1.75-slim as builder # Generated from Nickel template - DO NOT EDIT DIRECTLY
# Source: provisioning/schemas/platform/templates/docker/Dockerfile.chef.ncl
WORKDIR /app # ============================================================================
# Stage 1: PLANNER - Generate dependency recipe
# ============================================================================
FROM rust:1.82-trixie AS planner
WORKDIR /workspace
# Install cargo-chef
RUN cargo install cargo-chef --version 0.1.67
# Copy workspace manifests
COPY Cargo.toml Cargo.lock ./
COPY crates ./crates
COPY daemon-cli ./daemon-cli
COPY secretumvault ./secretumvault
COPY prov-ecosystem ./prov-ecosystem
COPY stratumiops ./stratumiops
# Generate recipe.json (dependency graph)
RUN cargo chef prepare --recipe-path recipe.json --bin extension-registry
# ============================================================================
# Stage 2: CACHER - Build dependencies only
# ============================================================================
FROM rust:1.82-trixie AS cacher
WORKDIR /workspace
# Install build dependencies # Install build dependencies
RUN apt-get update && apt-get install -y \ RUN apt-get update && apt-get install -y \
@ -9,40 +36,84 @@ RUN apt-get update && apt-get install -y \
libssl-dev \ libssl-dev \
&& rm -rf /var/lib/apt/lists/* && rm -rf /var/lib/apt/lists/*
# Copy manifests # Install cargo-chef
COPY Cargo.toml Cargo.lock ./ RUN cargo install cargo-chef --version 0.1.67
# sccache disabled
# Copy recipe from planner
COPY --from=planner /workspace/recipe.json recipe.json
# Build dependencies - This layer will be cached
RUN cargo chef cook --release --recipe-path recipe.json
# ============================================================================
# Stage 3: BUILDER - Build source code
# ============================================================================
FROM rust:1.82-trixie AS builder
WORKDIR /workspace
# Install build dependencies
RUN apt-get update && apt-get install -y \
pkg-config \
libssl-dev \
&& rm -rf /var/lib/apt/lists/*
# sccache disabled
# Copy cached dependencies from cacher stage
COPY --from=cacher /workspace/target target
COPY --from=cacher /usr/local/cargo /usr/local/cargo
# Copy source code # Copy source code
COPY src ./src COPY Cargo.toml Cargo.lock ./
COPY crates ./crates
COPY daemon-cli ./daemon-cli
COPY secretumvault ./secretumvault
COPY prov-ecosystem ./prov-ecosystem
COPY stratumiops ./stratumiops
# Build release binary # Build release binary with parallelism
RUN cargo build --release ENV CARGO_BUILD_JOBS=4
RUN cargo build --release --package extension-registry
# Runtime stage # ============================================================================
FROM debian:bookworm-slim # Stage 4: RUNTIME - Minimal runtime image
# ============================================================================
FROM debian:trixie-slim
# Install runtime dependencies # Install runtime dependencies
RUN apt-get update && apt-get install -y \ RUN apt-get update && apt-get install -y \
ca-certificates \ ca-certificates \
curl \
&& rm -rf /var/lib/apt/lists/* && rm -rf /var/lib/apt/lists/*
# Create non-root user # Create non-root user
RUN useradd -m -u 1000 registry && \ RUN useradd -m -u 1000 provisioning && \
mkdir -p /app/data && \ mkdir -p /data /var/log/extension-registry && \
chown -R registry:registry /app chown -R provisioning:provisioning /data /var/log/extension-registry
USER registry
WORKDIR /app
# Copy binary from builder # Copy binary from builder
COPY --from=builder /app/target/release/extension-registry /usr/local/bin/ COPY --from=builder /workspace/target/release/extension-registry /usr/local/bin/extension-registry
RUN chmod +x /usr/local/bin/extension-registry
# Expose port # No config file to copy
EXPOSE 8082
# Switch to non-root user
USER provisioning
WORKDIR /app
# Expose service port
EXPOSE 9093
# Environment variables
ENV RUST_LOG=info
ENV DATA_DIR=/data
# Health check # Health check
HEALTHCHECK --interval=30s --timeout=3s --start-period=5s --retries=3 \ HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \
CMD curl -f http://localhost:8082/api/v1/health || exit 1 CMD curl -f http://localhost:9093/health || exit 1
# Run service # Run the binary
CMD ["extension-registry"] CMD ["extension-registry"]

View File

@ -287,5 +287,6 @@ pub fn routes(state: AppState) -> Router {
.route("/extensions/:name", get(get_extension)) .route("/extensions/:name", get(get_extension))
// Health // Health
.route("/health", get(health)) .route("/health", get(health))
.route("/api/v1/health", get(health))
.with_state(state) .with_state(state)
} }

View File

@ -13,6 +13,18 @@ use handlers::{routes, AppState};
#[command(name = "extension-registry")] #[command(name = "extension-registry")]
#[command(about = "OCI-compliant extension registry proxy", long_about = None)] #[command(about = "OCI-compliant extension registry proxy", long_about = None)]
struct Cli { struct Cli {
/// Configuration file path (highest priority)
#[arg(short = 'c', long, env = "EXTENSION_REGISTRY_CONFIG")]
config: Option<std::path::PathBuf>,
/// Configuration directory (searches for extension-registry.ncl|toml|json)
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
config_dir: Option<std::path::PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
#[arg(short = 'm', long, env = "EXTENSION_REGISTRY_MODE")]
mode: Option<String>,
/// Host to bind to /// Host to bind to
#[arg(long, default_value = "127.0.0.1")] #[arg(long, default_value = "127.0.0.1")]
host: String, host: String,

View File

@ -1,14 +1,18 @@
[package] [package]
authors = ["Jesús Pérez Lorenzo <jpl@jesusperez.pro>"] authors.workspace = true
categories = ["command-line-utilities", "development-tools"] categories = ["command-line-utilities", "development-tools"]
description = "Rust-native MCP server for Infrastructure Automation system" description = "Rust-native MCP server for Infrastructure Automation system"
edition.workspace = true edition.workspace = true
keywords = ["mcp", "rust", "infrastructure", "provisioning", "ai"] keywords = ["mcp", "rust", "infrastructure", "provisioning", "ai"]
license.workspace = true license.workspace = true
name = "provisioning-mcp-server" name = "mcp-server"
repository.workspace = true repository.workspace = true
version.workspace = true version.workspace = true
[[bin]]
name = "provisioning-mcp-server"
path = "src/simple_main.rs"
[dependencies] [dependencies]
# ============================================================================ # ============================================================================
# WORKSPACE DEPENDENCIES # WORKSPACE DEPENDENCIES
@ -23,7 +27,7 @@ serde_json = { workspace = true }
toml = { workspace = true } toml = { workspace = true }
# Platform configuration # Platform configuration
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Error handling # Error handling
anyhow = { workspace = true } anyhow = { workspace = true }
@ -63,13 +67,13 @@ walkdir = { workspace = true }
# rust-mcp-sdk = "0.7.0" # rust-mcp-sdk = "0.7.0"
# RAG System (from provisioning-rag crate) # RAG System (from provisioning-rag crate)
provisioning-rag = { path = "../rag", features = [] } rag = { path = "../rag", features = [] }
# Date/time utilities # Date/time utilities
chrono = { workspace = true } chrono = { workspace = true }
# YAML parsing # YAML parsing
serde_yaml = "0.9" serde_yaml = { workspace = true }
# Directory utilities # Directory utilities
dirs = { workspace = true } dirs = { workspace = true }
@ -83,14 +87,8 @@ tokio-test = { workspace = true }
debug = ["tracing-subscriber/json"] debug = ["tracing-subscriber/json"]
default = [] default = []
[[bin]] # Note: simple_main.rs is the active entry point
name = "provisioning-mcp-server" # main.rs uses incompatible rust_mcp_sdk v0.7.0 API and is disabled
path = "src/simple_main.rs"
# Disabled: main.rs uses incompatible rust_mcp_sdk v0.7.0 API
# [[bin]]
# name = "provisioning-mcp-server-full"
# path = "src/main.rs"
[lib] [lib]
name = "provisioning_mcp_server" name = "provisioning_mcp_server"

View File

@ -1,63 +0,0 @@
# Build stage
FROM rust:1.75-slim as builder
WORKDIR /app
# Install build dependencies
RUN apt-get update && apt-get install -y \
pkg-config \
libssl-dev \
&& rm -rf /var/lib/apt/lists/*
# Copy manifests
COPY Cargo.toml Cargo.lock ./
# Create dummy source to cache dependencies
RUN mkdir -p src && \
echo "fn main() {}" > src/main.rs && \
cargo build --release && \
rm -rf src
# Copy actual source code
COPY src ./src
# Build release binary
RUN cargo build --release --bin mcp-server
# Runtime stage
FROM debian:bookworm-slim
# Install runtime dependencies
RUN apt-get update && apt-get install -y \
ca-certificates \
curl \
&& rm -rf /var/lib/apt/lists/*
# Create non-root user
RUN useradd -m -u 1000 provisioning && \
mkdir -p /data /var/log/mcp-server && \
chown -R provisioning:provisioning /data /var/log/mcp-server
# Copy binary from builder
COPY --from=builder /app/target/release/mcp-server /usr/local/bin/
# Copy default configuration
COPY config.defaults.toml /etc/provisioning/mcp-config.defaults.toml
# Switch to non-root user
USER provisioning
WORKDIR /app
# Expose port
EXPOSE 8084
# Set environment variables
ENV RUST_LOG=info
ENV MCP_PROTOCOL=http
# Health check
HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \
CMD curl -f http://localhost:8084/health || exit 1
# Run the binary
CMD ["mcp-server"]

View File

@ -2,7 +2,7 @@
authors.workspace = true authors.workspace = true
description = "Cloud-native infrastructure orchestrator with Nushell integration" description = "Cloud-native infrastructure orchestrator with Nushell integration"
edition.workspace = true edition.workspace = true
name = "provisioning-orchestrator" name = "orchestrator"
version.workspace = true version.workspace = true
[dependencies] [dependencies]
@ -45,28 +45,28 @@ clap = { workspace = true }
tracing-subscriber = { workspace = true } tracing-subscriber = { workspace = true }
# Docker/Container management # Docker/Container management
bollard = "0.17" bollard = { workspace = true }
# HTTP client for DNS/OCI/services # HTTP client for DNS/OCI/services
reqwest = { workspace = true } reqwest = { workspace = true }
# HTTP service clients (machines, init, AI) - enables remote service calls # HTTP service clients (machines, init, AI) - enables remote service calls
service-clients = { path = "../service-clients" } service-clients = { workspace = true }
# Platform configuration management # Platform configuration management
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# LRU cache for OCI manifests # LRU cache for OCI manifests
lru = "0.12" lru = { workspace = true }
# Authorization policy engine # Authorization policy engine
cedar-policy = "4.2" cedar-policy = { workspace = true }
# File system watcher for hot reload # File system watcher for hot reload
notify = "6.1" notify = { workspace = true }
# Base64 encoding/decoding # Base64 encoding/decoding
base64 = "0.22" base64 = { workspace = true }
# JWT token validation # JWT token validation
jsonwebtoken = { workspace = true } jsonwebtoken = { workspace = true }
@ -78,14 +78,14 @@ rsa = { workspace = true }
sha2 = { workspace = true } sha2 = { workspace = true }
# SSH key management # SSH key management
ed25519-dalek = "2.1" ed25519-dalek = { workspace = true }
# SSH client library (pure Rust, async-first) # SSH client library (pure Rust, async-first)
russh = "0.44" russh = { workspace = true }
russh-keys = "0.44" russh-keys = { workspace = true }
# Path expansion for tilde (~) handling # Path expansion for tilde (~) handling
shellexpand = "3.1" shellexpand = { workspace = true }
# ============================================================================ # ============================================================================
# FEATURE-GATED OPTIONAL DEPENDENCIES # FEATURE-GATED OPTIONAL DEPENDENCIES
@ -141,9 +141,18 @@ http-api = ["core"]
# SurrealDB: Optional storage backend # SurrealDB: Optional storage backend
surrealdb = ["dep:surrealdb"] surrealdb = ["dep:surrealdb"]
# Default: Recommended for standard deployments # Default: All features enabled
# Includes core, audit, compliance, platform, ssh, workflow default = [
default = ["core", "audit", "compliance", "platform", "ssh", "workflow", "http-api"] "core",
"audit",
"compliance",
"platform",
"ssh",
"workflow",
"testing",
"http-api",
"surrealdb",
]
# Full: All features enabled (development and testing) # Full: All features enabled (development and testing)
all = [ all = [
@ -170,11 +179,10 @@ tower = { workspace = true, features = ["util"] }
name = "provisioning_orchestrator" name = "provisioning_orchestrator"
path = "src/lib.rs" path = "src/lib.rs"
# Binary target (requires testing feature for test environment API) # Binary target (uses all features by default)
[[bin]] [[bin]]
name = "provisioning-orchestrator" name = "provisioning-orchestrator"
path = "src/main.rs" path = "src/main.rs"
required-features = ["all"]
[[bench]] [[bench]]
harness = false harness = false

View File

@ -1,8 +1,32 @@
# Multi-stage build for Orchestrator # Multi-stage build for provisioning-orchestrator
# Builds from platform workspace root # Generated from Nickel template - DO NOT EDIT DIRECTLY
# Source: provisioning/schemas/platform/templates/docker/Dockerfile.chef.ncl
# Build stage - Using nightly for consistency with control-center # ============================================================================
FROM rustlang/rust:nightly-bookworm AS builder # Stage 1: PLANNER - Generate dependency recipe
# ============================================================================
FROM rust:1.82-trixie AS planner
WORKDIR /workspace
# Install cargo-chef
RUN cargo install cargo-chef --version 0.1.67
# Copy workspace manifests
COPY Cargo.toml Cargo.lock ./
COPY crates ./crates
COPY daemon-cli ./daemon-cli
COPY secretumvault ./secretumvault
COPY prov-ecosystem ./prov-ecosystem
COPY stratumiops ./stratumiops
# Generate recipe.json (dependency graph)
RUN cargo chef prepare --recipe-path recipe.json --bin provisioning-orchestrator
# ============================================================================
# Stage 2: CACHER - Build dependencies only
# ============================================================================
FROM rust:1.82-trixie AS cacher
WORKDIR /workspace WORKDIR /workspace
@ -12,20 +36,52 @@ RUN apt-get update && apt-get install -y \
libssl-dev \ libssl-dev \
&& rm -rf /var/lib/apt/lists/* && rm -rf /var/lib/apt/lists/*
# Copy entire platform workspace (required for workspace dependencies) # Install cargo-chef
COPY Cargo.toml Cargo.lock ./ RUN cargo install cargo-chef --version 0.1.67
COPY orchestrator ./orchestrator
COPY control-center ./control-center # sccache disabled
COPY control-center-ui ./control-center-ui
COPY mcp-server ./mcp-server # Copy recipe from planner
COPY installer ./installer COPY --from=planner /workspace/recipe.json recipe.json
# Build dependencies - This layer will be cached
RUN cargo chef cook --release --recipe-path recipe.json
# ============================================================================
# Stage 3: BUILDER - Build source code
# ============================================================================
FROM rust:1.82-trixie AS builder
# Build orchestrator (workspace-aware)
WORKDIR /workspace WORKDIR /workspace
# Install build dependencies
RUN apt-get update && apt-get install -y \
pkg-config \
libssl-dev \
&& rm -rf /var/lib/apt/lists/*
# sccache disabled
# Copy cached dependencies from cacher stage
COPY --from=cacher /workspace/target target
COPY --from=cacher /usr/local/cargo /usr/local/cargo
# Copy source code
COPY Cargo.toml Cargo.lock ./
COPY crates ./crates
COPY daemon-cli ./daemon-cli
COPY secretumvault ./secretumvault
COPY prov-ecosystem ./prov-ecosystem
COPY stratumiops ./stratumiops
# Build release binary with parallelism
ENV CARGO_BUILD_JOBS=4
RUN cargo build --release --package provisioning-orchestrator RUN cargo build --release --package provisioning-orchestrator
# Runtime stage # ============================================================================
FROM debian:bookworm-slim # Stage 4: RUNTIME - Minimal runtime image
# ============================================================================
FROM debian:trixie-slim
# Install runtime dependencies # Install runtime dependencies
RUN apt-get update && apt-get install -y \ RUN apt-get update && apt-get install -y \
@ -35,30 +91,29 @@ RUN apt-get update && apt-get install -y \
# Create non-root user # Create non-root user
RUN useradd -m -u 1000 provisioning && \ RUN useradd -m -u 1000 provisioning && \
mkdir -p /data /var/log/orchestrator && \ mkdir -p /data /var/log/provisioning-orchestrator && \
chown -R provisioning:provisioning /data /var/log/orchestrator chown -R provisioning:provisioning /data /var/log/provisioning-orchestrator
# Copy binary from builder # Copy binary from builder
COPY --from=builder /workspace/target/release/provisioning-orchestrator /usr/local/bin/provisioning-orchestrator COPY --from=builder /workspace/target/release/provisioning-orchestrator /usr/local/bin/provisioning-orchestrator
RUN chmod +x /usr/local/bin/provisioning-orchestrator RUN chmod +x /usr/local/bin/provisioning-orchestrator
# Copy default configuration COPY crates/provisioning-orchestrator/config.defaults.toml /etc/provisioning/config.defaults.toml
COPY orchestrator/config.defaults.toml /etc/provisioning/config.defaults.toml
# Switch to non-root user # Switch to non-root user
USER provisioning USER provisioning
WORKDIR /app WORKDIR /app
# Expose port # Expose service port
EXPOSE 8080 EXPOSE 9090
# Set environment variables # Environment variables
ENV RUST_LOG=info ENV RUST_LOG=info
ENV DATA_DIR=/data ENV DATA_DIR=/data
# Health check # Health check
HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \ HEALTHCHECK --interval=30s --timeout=10s --start-period=30s --retries=3 \
CMD curl -f http://localhost:8080/health || exit 1 CMD curl -f http://localhost:9090/health || exit 1
# Run the binary # Run the binary
CMD ["provisioning-orchestrator"] CMD ["provisioning-orchestrator"]

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 14043518-e459-4316-aadd-6ee6d221e644
Timestamp: 2026-01-06 12:47:28 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmpdtjZLt/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 1e9b4914-f290-4bec-80f2-35128250f9fd
Timestamp: 2026-01-06 12:50:41 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmp9wM3YA/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 21c8a4af-2562-4304-b5ec-90fb1b5fd0ab
Timestamp: 2026-01-06 13:10:16 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmpnoxnXR/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 317e31fa-b549-49c9-a212-1f13445d913f
Timestamp: 2026-01-06 12:49:14 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmpe5B6TH/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 5da5d888-527e-4aac-ab53-93e9a30014cc
Timestamp: 2026-01-06 12:53:52 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmpOI6ga7/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: 7c16746f-24b0-4bcc-8a49-b5dc6bc1f0c7
Timestamp: 2026-01-06 12:59:15 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmp8JuU01/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -1,20 +0,0 @@
Manual Rollback Instructions for Migration migration-123
=============================================
Migration ID: migration-123
Rollback ID: cb3ced5a-ab49-4754-ba90-c815ab0948ba
Timestamp: 2026-01-06 12:53:37 UTC
Steps to rollback:
1. Stop the orchestrator service
2. If backup exists at '/var/folders/my/jvl5hd5x6rgbhks6yszk213c0000gn/T/.tmpI1vYTj/backup.json', restore it to target storage
3. Verify target storage contains original data
4. Remove any partially migrated data
5. Restart orchestrator service
Storage-specific cleanup commands:
- For filesystem: Remove or rename target directory
- For SurrealDB embedded: Delete database files in target directory
- For SurrealDB server: Connect and drop/recreate database
IMPORTANT: Test data integrity before resuming operations!

View File

@ -8,16 +8,14 @@ use std::default::Default;
use anyhow::{anyhow, Context, Result}; use anyhow::{anyhow, Context, Result};
use bollard::{ use bollard::{
container::{
Config, CreateContainerOptions, ListContainersOptions, LogsOptions, NetworkingConfig,
RemoveContainerOptions, StartContainerOptions, StopContainerOptions,
},
exec::{CreateExecOptions, StartExecResults}, exec::{CreateExecOptions, StartExecResults},
image::CreateImageOptions, models::{
network::CreateNetworkOptions, ContainerCreateBody, ContainerSummary, EndpointSettings, HostConfig, Ipam, IpamConfig,
service::{ NetworkingConfig, RestartPolicy, RestartPolicyNameEnum,
ContainerSummary, EndpointSettings, HostConfig, Ipam, IpamConfig, RestartPolicy, },
RestartPolicyNameEnum, query_parameters::{
CreateContainerOptions, CreateImageOptions, ListContainersOptions, LogsOptions,
RemoveContainerOptions, StartContainerOptions, StopContainerOptions,
}, },
Docker, Docker,
}; };
@ -58,6 +56,8 @@ impl ContainerManager {
/// Create network for test environment /// Create network for test environment
pub async fn create_network(&self, config: &NetworkConfig) -> Result<String> { pub async fn create_network(&self, config: &NetworkConfig) -> Result<String> {
use bollard::models::NetworkCreateRequest;
let ipam_config = IpamConfig { let ipam_config = IpamConfig {
subnet: Some(config.subnet.clone()), subnet: Some(config.subnet.clone()),
gateway: None, gateway: None,
@ -71,36 +71,32 @@ impl ContainerManager {
options: None, options: None,
}; };
let create_options = CreateNetworkOptions { let mut labels = HashMap::new();
labels.insert(
"managed_by".to_string(),
"provisioning_orchestrator".to_string(),
);
labels.insert("type".to_string(), "test_environment".to_string());
let create_request = NetworkCreateRequest {
name: config.name.clone(), name: config.name.clone(),
check_duplicate: true, driver: Some("bridge".to_string()),
driver: "bridge".to_string(), internal: Some(false),
internal: false, attachable: Some(true),
attachable: true, ipam: Some(ipam),
ingress: false, enable_ipv4: Some(true),
ipam, options: Some(HashMap::new()),
enable_ipv6: false, labels: Some(labels),
options: HashMap::new(), ..Default::default()
labels: {
let mut labels = HashMap::new();
labels.insert(
"managed_by".to_string(),
"provisioning_orchestrator".to_string(),
);
labels.insert("type".to_string(), "test_environment".to_string());
labels
},
}; };
let response = self let response = self
.docker .docker
.create_network(create_options) .create_network(create_request)
.await .await
.context("Failed to create Docker network")?; .context("Failed to create Docker network")?;
let network_id = response let network_id = response.id;
.id
.ok_or_else(|| anyhow!("Network ID not returned"))?;
info!("Created network {} ({})", config.name, network_id); info!("Created network {} ({})", config.name, network_id);
Ok(network_id) Ok(network_id)
@ -119,12 +115,12 @@ impl ContainerManager {
/// Pull image if not exists /// Pull image if not exists
pub async fn ensure_image(&self, image: &str) -> Result<()> { pub async fn ensure_image(&self, image: &str) -> Result<()> {
let options = Some(CreateImageOptions { let options = CreateImageOptions {
from_image: image, from_image: Some(image.to_string()),
..Default::default() ..Default::default()
}); };
let mut stream = self.docker.create_image(options, None, None); let mut stream = self.docker.create_image(Some(options), None, None);
while let Some(result) = stream.next().await { while let Some(result) = stream.next().await {
match result { match result {
@ -176,7 +172,6 @@ impl ContainerManager {
endpoint_config.insert( endpoint_config.insert(
net_id.to_string(), net_id.to_string(),
EndpointSettings { EndpointSettings {
network_id: Some(net_id.to_string()),
..Default::default() ..Default::default()
}, },
); );
@ -190,31 +185,30 @@ impl ContainerManager {
.collect(); .collect();
// Container configuration // Container configuration
let config = Config { let mut labels = HashMap::new();
labels.insert(
"managed_by".to_string(),
"provisioning_orchestrator".to_string(),
);
labels.insert("type".to_string(), "test_container".to_string());
labels.insert("test_name".to_string(), name.to_string());
let config = ContainerCreateBody {
image: Some(image.to_string()), image: Some(image.to_string()),
hostname: Some(name.to_string()), hostname: Some(name.to_string()),
env: Some(env), env: if env.is_empty() { None } else { Some(env) },
cmd: command, cmd: command,
host_config: Some(host_config), host_config: Some(host_config),
networking_config: Some(NetworkingConfig { networking_config: Some(NetworkingConfig {
endpoints_config: endpoint_config, endpoints_config: Some(endpoint_config),
}),
labels: Some({
let mut labels = HashMap::new();
labels.insert(
"managed_by".to_string(),
"provisioning_orchestrator".to_string(),
);
labels.insert("type".to_string(), "test_container".to_string());
labels.insert("test_name".to_string(), name.to_string());
labels
}), }),
labels: Some(labels),
..Default::default() ..Default::default()
}; };
let options = CreateContainerOptions { let options = CreateContainerOptions {
name: name.to_string(), name: Some(name.to_string()),
platform: None, platform: String::new(),
}; };
let response = self let response = self
@ -240,7 +234,7 @@ impl ContainerManager {
/// Start container /// Start container
pub async fn start_container(&self, container_id: &str) -> Result<()> { pub async fn start_container(&self, container_id: &str) -> Result<()> {
self.docker self.docker
.start_container(container_id, None::<StartContainerOptions<String>>) .start_container(container_id, None::<StartContainerOptions>)
.await .await
.context(format!("Failed to start container {}", container_id))?; .context(format!("Failed to start container {}", container_id))?;
@ -251,7 +245,8 @@ impl ContainerManager {
/// Stop container /// Stop container
pub async fn stop_container(&self, container_id: &str, timeout: Option<i64>) -> Result<()> { pub async fn stop_container(&self, container_id: &str, timeout: Option<i64>) -> Result<()> {
let options = StopContainerOptions { let options = StopContainerOptions {
t: timeout.unwrap_or(10), t: Some(timeout.unwrap_or(10) as i32),
signal: None,
}; };
self.docker self.docker
@ -329,7 +324,7 @@ impl ContainerManager {
container_id: &str, container_id: &str,
tail: Option<&str>, tail: Option<&str>,
) -> Result<String> { ) -> Result<String> {
let options = LogsOptions::<String> { let options = LogsOptions {
stdout: true, stdout: true,
stderr: true, stderr: true,
tail: tail.unwrap_or("100").to_string(), tail: tail.unwrap_or("100").to_string(),
@ -386,15 +381,15 @@ impl ContainerManager {
let mut filters = HashMap::new(); let mut filters = HashMap::new();
filters.insert("label".to_string(), vec![format!("{}={}", label, value)]); filters.insert("label".to_string(), vec![format!("{}={}", label, value)]);
let options = Some(ListContainersOptions { let options = ListContainersOptions {
all: true, all: true,
filters, filters: Some(filters),
..Default::default() ..Default::default()
}); };
let containers = self let containers = self
.docker .docker
.list_containers(options) .list_containers(Some(options))
.await .await
.context("Failed to list containers")?; .context("Failed to list containers")?;

View File

@ -85,14 +85,36 @@ pub fn validate_storage_type(s: &str) -> Result<String, String> {
// CLI arguments structure // CLI arguments structure
#[derive(clap::Parser, Clone)] #[derive(clap::Parser, Clone)]
#[command(author, version, about, long_about = None)] #[command(author, version, about = "Multi-service task orchestration and batch workflow engine")]
#[command(long_about = "Orchestrator - Manages distributed task execution, batch workflows, and cluster provisioning with state management and rollback recovery")]
#[command(after_help = "CONFIGURATION HIERARCHY (highest to lowest priority):\n 1. CLI: -c/--config <path> (explicit file)\n 2. CLI: --config-dir <dir> --mode <mode> (directory + mode)\n 3. CLI: --config-dir <dir> (searches for orchestrator.ncl|toml|json)\n 4. CLI: --mode <mode> (searches in provisioning/platform/config/)\n 5. ENV: ORCHESTRATOR_CONFIG (explicit file)\n 6. ENV: PROVISIONING_CONFIG_DIR (searches for orchestrator.ncl|toml|json)\n 7. ENV: ORCHESTRATOR_MODE (mode-based in default path)\n 8. Built-in defaults\n\nEXAMPLES:\n # Explicit config file\n orchestrator -c ~/my-config.toml\n\n # Config directory with mode\n orchestrator --config-dir ~/configs --mode enterprise\n\n # Config directory (auto-discover file)\n orchestrator --config-dir ~/.config/provisioning\n\n # Via environment variables\n export ORCHESTRATOR_CONFIG=~/.config/orchestrator.toml\n orchestrator\n\n # Mode-based configuration\n orchestrator --mode solo")]
pub struct Args { pub struct Args {
/// Configuration file path (highest priority)
///
/// Accepts absolute or relative path. Supports .ncl, .toml, and .json formats.
#[arg(short = 'c', long, env = "ORCHESTRATOR_CONFIG")]
pub config: Option<std::path::PathBuf>,
/// Configuration directory (searches for orchestrator.ncl|toml|json)
///
/// Searches for configuration files in order of preference: .ncl > .toml > .json
/// Can also search for mode-specific files: orchestrator.{mode}.{ncl|toml|json}
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
pub config_dir: Option<std::path::PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
///
/// Determines which configuration profile to use. Searches in:
/// provisioning/platform/config/orchestrator.{mode}.{ncl|toml}
#[arg(short = 'm', long, env = "ORCHESTRATOR_MODE")]
pub mode: Option<String>,
/// Port to listen on /// Port to listen on
#[arg(short, long, default_value = "9090")] #[arg(short = 'p', long, default_value = "9090")]
pub port: u16, pub port: u16,
/// Data directory for storage /// Data directory for storage
#[arg(short, long, default_value = "./data")] #[arg(short = 'd', long, default_value = "./data")]
pub data_dir: String, pub data_dir: String,
/// Storage backend type /// Storage backend type

View File

@ -1007,6 +1007,7 @@ async fn main() -> Result<()> {
let app = Router::new() let app = Router::new()
.route("/health", get(health_check)) .route("/health", get(health_check))
.route("/api/v1/health", get(health_check))
.route("/tasks", get(list_tasks)) .route("/tasks", get(list_tasks))
.route("/tasks/{id}", get(get_task_status)) .route("/tasks/{id}", get(get_task_status))
.route("/workflows/servers/create", post(create_server_workflow)) .route("/workflows/servers/create", post(create_server_workflow))

View File

@ -8,7 +8,7 @@ const CONFIG_BASE_PATH: &str = "provisioning/platform/config";
/// 2. Variable de entorno {SERVICE}_MODE + búsqueda de archivo /// 2. Variable de entorno {SERVICE}_MODE + búsqueda de archivo
/// 3. Fallback a defaults /// 3. Fallback a defaults
pub fn resolve_config_path(service_name: &str) -> Option<PathBuf> { pub fn resolve_config_path(service_name: &str) -> Option<PathBuf> {
// Paso 1: Check {SERVICE}_CONFIG env var (explicit path) // Priority 1: Check {SERVICE}_CONFIG env var (explicit path)
let env_var = format!("{}_CONFIG", service_name.to_uppercase().replace('-', "_")); let env_var = format!("{}_CONFIG", service_name.to_uppercase().replace('-', "_"));
if let Ok(path) = env::var(&env_var) { if let Ok(path) = env::var(&env_var) {
let config_path = PathBuf::from(path); let config_path = PathBuf::from(path);
@ -22,7 +22,18 @@ pub fn resolve_config_path(service_name: &str) -> Option<PathBuf> {
} }
} }
// Paso 2: Check {SERVICE}_MODE env var + find config file // Priority 2: Check PROVISIONING_CONFIG_DIR env var
if let Ok(dir) = env::var("PROVISIONING_CONFIG_DIR") {
if let Some(config) = super::resolver::find_config_in_dir(std::path::Path::new(&dir), service_name) {
tracing::debug!(
"Using config from PROVISIONING_CONFIG_DIR: {:?}",
config
);
return Some(config);
}
}
// Priority 3: Check {SERVICE}_MODE env var + find config file
let mode_var = format!("{}_MODE", service_name.to_uppercase().replace('-', "_")); let mode_var = format!("{}_MODE", service_name.to_uppercase().replace('-', "_"));
let mode = env::var(&mode_var).unwrap_or_else(|_| "solo".to_string()); let mode = env::var(&mode_var).unwrap_or_else(|_| "solo".to_string());
@ -36,7 +47,7 @@ pub fn resolve_config_path(service_name: &str) -> Option<PathBuf> {
return Some(path); return Some(path);
} }
// Paso 3: Fallback - no config file found // Fallback - no config file found
tracing::debug!( tracing::debug!(
"No config file found for {}.{} - using defaults", "No config file found for {}.{} - using defaults",
service_name, service_name,

View File

@ -53,6 +53,7 @@ pub mod format;
pub mod hierarchy; pub mod hierarchy;
pub mod loader; pub mod loader;
pub mod nickel; pub mod nickel;
pub mod resolver;
// Re-export main types // Re-export main types
pub use error::{ConfigError, Result}; pub use error::{ConfigError, Result};
@ -60,3 +61,4 @@ pub use format::ConfigLoader;
pub use hierarchy::{config_base_path, find_config_file, resolve_config_path}; pub use hierarchy::{config_base_path, find_config_file, resolve_config_path};
pub use loader::{ConfigLoaderExt, ConfigValidator}; pub use loader::{ConfigLoaderExt, ConfigValidator};
pub use nickel::is_nickel_available; pub use nickel::is_nickel_available;
pub use resolver::{ConfigResolver, find_config_in_dir, find_config_in_dir_with_mode};

View File

@ -0,0 +1,212 @@
use std::path::{Path, PathBuf};
/// Resolves configuration file paths with CLI flags priority
#[derive(Debug, Clone, Default)]
pub struct ConfigResolver {
cli_config: Option<PathBuf>,
cli_config_dir: Option<PathBuf>,
cli_mode: Option<String>,
}
impl ConfigResolver {
/// Create a new ConfigResolver with no CLI overrides
pub fn new() -> Self {
Self {
cli_config: None,
cli_config_dir: None,
cli_mode: None,
}
}
/// Set explicit config file path (highest priority)
pub fn with_cli_config(mut self, path: Option<PathBuf>) -> Self {
self.cli_config = path;
self
}
/// Set config directory (searches for {service}.{ncl|toml|json})
pub fn with_cli_config_dir(mut self, dir: Option<PathBuf>) -> Self {
self.cli_config_dir = dir;
self
}
/// Set deployment mode for config resolution
pub fn with_cli_mode(mut self, mode: Option<String>) -> Self {
self.cli_mode = mode;
self
}
/// Resolve config file path with priority order:
/// 1. CLI flag: -config <path> (explicit file)
/// 2. CLI flag: --config-dir <dir> --mode <mode> (directory + mode)
/// 3. CLI flag: --config-dir <dir> (directory, default naming)
/// 4. CLI flag: --mode <mode> (mode in default path)
/// 5. ENV var: {SERVICE}_CONFIG (explicit file)
/// 6. ENV var: PROVISIONING_CONFIG_DIR (directory, default naming)
/// 7. ENV var: {SERVICE}_MODE (mode in default path)
/// 8. None (fallback to defaults)
pub fn resolve(&self, service_name: &str) -> Option<PathBuf> {
// Priority 1: CLI flag explicit path
if let Some(ref path) = self.cli_config {
tracing::debug!("Using CLI-provided config file: {:?}", path);
return Some(path.clone());
}
// Priority 2: CLI config-dir + mode
if let Some(ref dir) = self.cli_config_dir {
if let Some(ref mode) = self.cli_mode {
if let Some(config) = find_config_in_dir_with_mode(dir, service_name, mode) {
tracing::debug!(
"Using config file from CLI config-dir with mode: {:?}",
config
);
return Some(config);
}
}
}
// Priority 3: CLI config-dir only
if let Some(ref dir) = self.cli_config_dir {
if let Some(config) = find_config_in_dir(dir, service_name) {
tracing::debug!("Using config file from CLI config-dir: {:?}", config);
return Some(config);
}
}
// Priority 4: CLI mode only (searches in default path)
if let Some(ref mode) = self.cli_mode {
if let Some(config) = super::hierarchy::find_config_file(service_name, mode) {
tracing::debug!("Using config file with CLI mode: {:?}", config);
return Some(config);
}
}
// Priority 5-7: Fall back to environment variable resolution
super::hierarchy::resolve_config_path(service_name)
}
}
/// Search for config file in directory with specific mode
/// Searches in order: {service}.{mode}.ncl, {service}.{mode}.toml, {service}.{mode}.json
pub fn find_config_in_dir_with_mode(dir: &Path, service_name: &str, mode: &str) -> Option<PathBuf> {
for ext in &["ncl", "toml", "json"] {
let path = dir.join(format!("{}.{}.{}", service_name, mode, ext));
if path.exists() {
tracing::trace!("Found config with mode: {:?}", path);
return Some(path);
}
}
None
}
/// Search for config file in directory with default naming
/// Searches in order: {service}.ncl, {service}.toml, {service}.json
pub fn find_config_in_dir(dir: &Path, service_name: &str) -> Option<PathBuf> {
for ext in &["ncl", "toml", "json"] {
let path = dir.join(format!("{}.{}", service_name, ext));
if path.exists() {
tracing::trace!("Found config in dir: {:?}", path);
return Some(path);
}
}
None
}
#[cfg(test)]
mod tests {
use super::*;
use std::fs;
use tempfile::TempDir;
#[test]
fn test_cli_config_highest_priority() {
let resolver = ConfigResolver::new()
.with_cli_config(Some(PathBuf::from("/explicit/path.toml")));
let resolved = resolver.resolve("orchestrator");
assert_eq!(resolved, Some(PathBuf::from("/explicit/path.toml")));
}
#[test]
fn test_config_dir_searches_extensions_in_order() {
let temp_dir = TempDir::new().unwrap();
let ncl_path = temp_dir.path().join("orchestrator.ncl");
let toml_path = temp_dir.path().join("orchestrator.toml");
// Create both files
fs::write(&ncl_path, "{}").unwrap();
fs::write(&toml_path, "[orchestrator]").unwrap();
let resolver = ConfigResolver::new()
.with_cli_config_dir(Some(temp_dir.path().to_path_buf()));
let resolved = resolver.resolve("orchestrator").unwrap();
// Should prefer .ncl over .toml
assert_eq!(resolved, ncl_path);
}
#[test]
fn test_config_dir_with_mode() {
let temp_dir = TempDir::new().unwrap();
let enterprise_path = temp_dir.path().join("orchestrator.enterprise.toml");
fs::write(&enterprise_path, "[orchestrator]").unwrap();
let resolver = ConfigResolver::new()
.with_cli_config_dir(Some(temp_dir.path().to_path_buf()))
.with_cli_mode(Some("enterprise".to_string()));
let resolved = resolver.resolve("orchestrator").unwrap();
assert_eq!(resolved, enterprise_path);
}
#[test]
fn test_find_config_in_dir_prefers_ncl() {
let temp_dir = TempDir::new().unwrap();
let ncl_path = temp_dir.path().join("test-service.ncl");
let toml_path = temp_dir.path().join("test-service.toml");
let json_path = temp_dir.path().join("test-service.json");
fs::write(&ncl_path, "{}").unwrap();
fs::write(&toml_path, "[test]").unwrap();
fs::write(&json_path, "{}").unwrap();
let result = find_config_in_dir(temp_dir.path(), "test-service").unwrap();
assert_eq!(result, ncl_path);
}
#[test]
fn test_find_config_in_dir_with_mode_json_fallback() {
let temp_dir = TempDir::new().unwrap();
let json_path = temp_dir.path().join("test-service.solo.json");
fs::write(&json_path, "{}").unwrap();
let result = find_config_in_dir_with_mode(temp_dir.path(), "test-service", "solo").unwrap();
assert_eq!(result, json_path);
}
#[test]
fn test_no_config_found_returns_none() {
let temp_dir = TempDir::new().unwrap();
let resolver = ConfigResolver::new()
.with_cli_config_dir(Some(temp_dir.path().to_path_buf()));
let resolved = resolver.resolve("nonexistent-service");
assert!(resolved.is_none());
}
#[test]
fn test_cli_config_dir_overrides_env_var() {
let temp_dir = TempDir::new().unwrap();
let config_path = temp_dir.path().join("orchestrator.toml");
fs::write(&config_path, "[orchestrator]").unwrap();
// This test just verifies the resolver logic works correctly
// (actual env var override would need temp_env crate)
let resolver = ConfigResolver::new()
.with_cli_config_dir(Some(temp_dir.path().to_path_buf()));
let resolved = resolver.resolve("orchestrator").unwrap();
assert_eq!(resolved, config_path);
}
}

View File

@ -2,9 +2,13 @@
authors.workspace = true authors.workspace = true
description = "RAG system for provisioning platform with Rig framework and SurrealDB" description = "RAG system for provisioning platform with Rig framework and SurrealDB"
edition.workspace = true edition.workspace = true
name = "provisioning-rag" name = "rag"
version.workspace = true version.workspace = true
[[bin]]
name = "provisioning-rag"
path = "src/main.rs"
[dependencies] [dependencies]
# ============================================================================ # ============================================================================
# WORKSPACE DEPENDENCIES - Core async runtime and traits # WORKSPACE DEPENDENCIES - Core async runtime and traits
@ -41,7 +45,7 @@ reqwest = { workspace = true }
# REST API Framework (Phase 8) # REST API Framework (Phase 8)
# ============================================================================ # ============================================================================
axum = { workspace = true } axum = { workspace = true }
http = "1" http = { workspace = true }
hyper = { workspace = true, features = ["full"] } hyper = { workspace = true, features = ["full"] }
tower = { workspace = true } tower = { workspace = true }
tower-http = { workspace = true, features = ["cors", "trace"] } tower-http = { workspace = true, features = ["cors", "trace"] }
@ -61,7 +65,11 @@ walkdir = { workspace = true }
config = { workspace = true } config = { workspace = true }
# Platform configuration management # Platform configuration management
platform-config = { path = "../platform-config" } platform-config = { workspace = true }
# Stratum ecosystem - embeddings and LLM abstraction
stratum-embeddings = { workspace = true, features = ["openai-provider", "ollama-provider", "fastembed-provider"] }
stratum-llm = { workspace = true, features = ["anthropic", "openai", "ollama"] }
# Regex for document parsing # Regex for document parsing
regex = { workspace = true } regex = { workspace = true }
@ -97,13 +105,7 @@ name = "phase8_benchmarks"
name = "provisioning_rag" name = "provisioning_rag"
path = "src/lib.rs" path = "src/lib.rs"
# Binary target (optional CLI tool)
[[bin]]
name = "provisioning-rag"
path = "src/main.rs"
required-features = ["cli"]
# Features # Features
[features] [features]
cli = [] cli = []
default = [] default = ["cli"]

View File

@ -1,59 +0,0 @@
# Multi-stage build for Provisioning RAG Service
# Stage 1: Builder
FROM rust:1.80.1 as builder
WORKDIR /app
# Install dependencies
RUN apt-get update && apt-get install -y \
pkg-config \
libssl-dev \
&& rm -rf /var/lib/apt/lists/*
# Copy workspace and source
COPY Cargo.toml Cargo.lock ./
COPY provisioning/platform/rag ./rag
COPY provisioning/platform/rag/src ./src
COPY provisioning/platform/rag/benches ./benches
# Build the orchestrator binary in release mode
RUN cd rag && cargo build --release \
&& cp target/release/provisioning-rag /app/provisioning-rag
# Stage 2: Runtime
FROM debian:bookworm-slim
WORKDIR /app
# Install runtime dependencies
RUN apt-get update && apt-get install -y \
ca-certificates \
curl \
openssl \
&& rm -rf /var/lib/apt/lists/*
# Copy binary from builder
COPY --from=builder /app/provisioning-rag /app/
# Create non-root user for security
RUN useradd -m -u 1000 provisioning && \
chown -R provisioning:provisioning /app
USER provisioning
# Environment variables
ENV PROVISIONING_LOG_LEVEL=info
ENV PROVISIONING_API_HOST=0.0.0.0
ENV PROVISIONING_API_PORT=9090
ENV PROVISIONING_CACHE_SIZE=1000
ENV PROVISIONING_CACHE_TTL_SECS=3600
# Expose API port
EXPOSE 9090
# Health check
HEALTHCHECK --interval=30s --timeout=10s --start-period=5s --retries=3 \
CMD curl -f http://localhost:9090/health || exit 1
# Start the service
CMD ["/app/provisioning-rag"]

View File

@ -1,197 +1,157 @@
//! Embeddings module using Rig framework //! Embeddings module using stratum-embeddings
use std::collections::HashMap;
use std::sync::Arc; use std::sync::Arc;
use std::time::Duration;
use serde::{Deserialize, Serialize}; use serde::{Deserialize, Serialize};
use tokio::sync::Mutex; use stratum_embeddings::{
EmbeddingOptions, EmbeddingService, FastEmbedProvider, MemoryCache, OllamaModel,
OllamaProvider, OpenAiModel, OpenAiProvider,
};
use crate::config::EmbeddingConfig; use crate::config::EmbeddingConfig;
use crate::error::Result; use crate::error::Result;
/// Document chunk to be embedded
#[derive(Debug, Clone, Serialize, Deserialize)] #[derive(Debug, Clone, Serialize, Deserialize)]
pub struct DocumentChunk { pub struct DocumentChunk {
/// Unique chunk ID
pub id: String, pub id: String,
/// Source document path
pub source_path: String, pub source_path: String,
/// Document type (markdown, kcl, nushell, rust)
pub doc_type: String, pub doc_type: String,
/// Chunk content (text to embed)
pub content: String, pub content: String,
/// Document category for filtering
pub category: Option<String>, pub category: Option<String>,
pub metadata: HashMap<String, String>,
/// Metadata (headings, function names, etc.)
pub metadata: std::collections::HashMap<String, String>,
} }
/// Embedded document with vector
#[derive(Debug, Clone, Serialize, Deserialize)] #[derive(Debug, Clone, Serialize, Deserialize)]
pub struct EmbeddedDocument { pub struct EmbeddedDocument {
/// Chunk ID
pub id: String, pub id: String,
/// Source document path
pub source_path: String, pub source_path: String,
/// Document type
pub doc_type: String, pub doc_type: String,
/// Original content
pub content: String, pub content: String,
/// Embedding vector
pub embedding: Vec<f32>, pub embedding: Vec<f32>,
pub metadata: HashMap<String, String>,
/// Metadata
pub metadata: std::collections::HashMap<String, String>,
} }
/// OpenAI HTTP client wrapper for embeddings enum Service {
#[derive(Clone)] OpenAi(EmbeddingService<OpenAiProvider, MemoryCache>),
struct OpenAiClient { Ollama(EmbeddingService<OllamaProvider, MemoryCache>),
api_key: String, FastEmbed(EmbeddingService<FastEmbedProvider, MemoryCache>),
model: String,
dimension: usize,
} }
impl OpenAiClient {
/// Create new OpenAI client
fn new(api_key: String, model: String, dimension: usize) -> Self {
Self {
api_key,
model,
dimension,
}
}
/// Generate embedding via OpenAI API
async fn embed(&self, text: &str) -> Result<Vec<f32>> {
let client = reqwest::Client::new();
#[derive(serde::Serialize)]
struct EmbeddingRequest {
input: String,
model: String,
dimensions: Option<usize>,
}
#[derive(serde::Deserialize)]
struct EmbeddingResponse {
data: Vec<EmbeddingData>,
}
#[derive(serde::Deserialize)]
struct EmbeddingData {
embedding: Vec<f32>,
}
let request = EmbeddingRequest {
input: text.to_string(),
model: self.model.clone(),
dimensions: if self.dimension == 1536 {
None
} else {
Some(self.dimension)
},
};
let response = client
.post("https://api.openai.com/v1/embeddings")
.header("Authorization", format!("Bearer {}", self.api_key))
.header("Content-Type", "application/json")
.json(&request)
.send()
.await
.map_err(|e| {
crate::error::RagError::embedding(format!("Failed to call OpenAI API: {}", e))
})?;
if !response.status().is_success() {
let error_text = response
.text()
.await
.unwrap_or_else(|_| "Unknown error".to_string());
return Err(crate::error::RagError::embedding(format!(
"OpenAI API error: {}",
error_text
)));
}
let embedding_response: EmbeddingResponse = response.json().await.map_err(|e| {
crate::error::RagError::embedding(format!("Failed to parse OpenAI response: {}", e))
})?;
embedding_response
.data
.first()
.map(|d| d.embedding.clone())
.ok_or_else(|| crate::error::RagError::embedding("No embedding data in response"))
}
}
/// Embedding engine using OpenAI via HTTP
pub struct EmbeddingEngine { pub struct EmbeddingEngine {
config: EmbeddingConfig, config: EmbeddingConfig,
client: Arc<Mutex<Option<OpenAiClient>>>, service: Service,
} }
impl EmbeddingEngine { impl EmbeddingEngine {
/// Create a new embedding engine
pub fn new(config: EmbeddingConfig) -> Result<Self> { pub fn new(config: EmbeddingConfig) -> Result<Self> {
// Validate configuration let cache = MemoryCache::new(1000, Duration::from_secs(3600));
match config.provider.as_str() {
let service = match config.provider.as_str() {
"openai" => { "openai" => {
if config.openai_api_key.is_none() && !config.fallback_local { let api_key = config
.openai_api_key
.clone()
.or_else(|| std::env::var("OPENAI_API_KEY").ok());
let api_key_str = if let Some(key) = api_key {
key
} else if config.fallback_local {
"dummy".to_string() // Will fail, but fallback will take over
} else {
return Err(crate::error::RagError::config( return Err(crate::error::RagError::config(
"OpenAI API key required for OpenAI provider (or enable fallback_local). \ "OpenAI API key required. Set OPENAI_API_KEY or enable fallback_local",
Set OPENAI_API_KEY environment variable.",
)); ));
};
let model = match config.model.as_str() {
"text-embedding-3-small" => OpenAiModel::TextEmbedding3Small,
"text-embedding-3-large" => OpenAiModel::TextEmbedding3Large,
"text-embedding-ada-002" => OpenAiModel::TextEmbeddingAda002,
_ => {
tracing::warn!(
"Unknown model '{}', using text-embedding-3-small",
config.model
);
OpenAiModel::TextEmbedding3Small
}
};
let provider = OpenAiProvider::new(api_key_str, model).map_err(|e| {
crate::error::RagError::embedding(format!("OpenAI provider failed: {}", e))
})?;
let mut svc = EmbeddingService::new(provider).with_cache(cache);
if config.fallback_local {
tracing::info!("Fallback to local embeddings enabled");
let fallback = Arc::new(FastEmbedProvider::small().map_err(|e| {
crate::error::RagError::embedding(format!("Fallback failed: {}", e))
})?);
svc = svc.with_fallback(fallback);
} }
Service::OpenAi(svc)
} }
"ollama" => { "ollama" => {
tracing::info!("Using Ollama for local embeddings (no API costs)"); use stratum_embeddings::OllamaModel;
let model = if config.model == "nomic-embed-text" {
OllamaModel::NomicEmbed
} else if config.model == "mxbai-embed-large" {
OllamaModel::MxbaiEmbed
} else if config.model == "all-minilm" {
OllamaModel::AllMiniLm
} else {
OllamaModel::Custom(config.model.clone(), config.dimension)
};
let provider = OllamaProvider::new(model).map_err(|e| {
crate::error::RagError::embedding(format!("Ollama provider failed: {}", e))
})?;
Service::Ollama(EmbeddingService::new(provider).with_cache(cache))
} }
"local" => { "local" => {
tracing::info!("Using local embedding model (no API costs)"); tracing::info!("Using FastEmbed local embeddings (no API costs)");
let provider = FastEmbedProvider::small().map_err(|e| {
crate::error::RagError::embedding(format!("FastEmbed provider failed: {}", e))
})?;
Service::FastEmbed(EmbeddingService::new(provider).with_cache(cache))
} }
_ => { _ => {
return Err(crate::error::RagError::config(format!( return Err(crate::error::RagError::config(format!(
"Unknown embedding provider: {}. Supported: openai, ollama, local", "Unknown provider: {}. Supported: openai, ollama, local",
config.provider config.provider
))); )));
} }
} };
tracing::info!( tracing::info!(
"Initialized embedding engine: {} (provider: {}, dimension: {})", "Initialized stratum-embeddings: {} (provider: {}, dim: {})",
config.model, config.model,
config.provider, config.provider,
config.dimension config.dimension
); );
Ok(Self { Ok(Self { config, service })
config,
client: Arc::new(Mutex::new(None)),
})
} }
/// Get embedding configuration
pub fn config(&self) -> &EmbeddingConfig { pub fn config(&self) -> &EmbeddingConfig {
&self.config &self.config
} }
/// Embed a single chunk using Rig framework
///
/// This is a stub implementation that creates zero vectors.
/// In production, this would call the Rig embeddings API.
pub async fn embed_chunk(&self, chunk: &DocumentChunk) -> Result<EmbeddedDocument> { pub async fn embed_chunk(&self, chunk: &DocumentChunk) -> Result<EmbeddedDocument> {
let embedding = self.generate_embedding(&chunk.content).await?; let options = EmbeddingOptions::default_with_cache();
let embedding = match &self.service {
Service::OpenAi(svc) => svc.embed(&chunk.content, &options).await,
Service::Ollama(svc) => svc.embed(&chunk.content, &options).await,
Service::FastEmbed(svc) => svc.embed(&chunk.content, &options).await,
}
.map_err(|e| crate::error::RagError::embedding(format!("Embedding failed: {}", e)))?;
Ok(EmbeddedDocument { Ok(EmbeddedDocument {
id: chunk.id.clone(), id: chunk.id.clone(),
@ -203,133 +163,33 @@ impl EmbeddingEngine {
}) })
} }
/// Embed multiple chunks in batch
pub async fn embed_batch(&self, chunks: &[DocumentChunk]) -> Result<Vec<EmbeddedDocument>> { pub async fn embed_batch(&self, chunks: &[DocumentChunk]) -> Result<Vec<EmbeddedDocument>> {
let mut results = Vec::new(); let options = EmbeddingOptions::default_with_cache();
let texts: Vec<String> = chunks.iter().map(|c| c.content.clone()).collect();
for (idx, chunk) in chunks.iter().enumerate() { let result = match &self.service {
let embedded = self.embed_chunk(chunk).await?; Service::OpenAi(svc) => svc.embed_batch(texts, &options).await,
results.push(embedded); Service::Ollama(svc) => svc.embed_batch(texts, &options).await,
Service::FastEmbed(svc) => svc.embed_batch(texts, &options).await,
// Log progress
if (idx + 1) % 10 == 0 {
tracing::debug!("Embedded {}/{} chunks", idx + 1, chunks.len());
}
} }
.map_err(|e| crate::error::RagError::embedding(format!("Batch embed failed: {}", e)))?;
tracing::info!("Embedded {} chunks total", chunks.len()); let results = chunks
.iter()
.zip(result.embeddings)
.map(|(chunk, embedding)| EmbeddedDocument {
id: chunk.id.clone(),
source_path: chunk.source_path.clone(),
doc_type: chunk.doc_type.clone(),
content: chunk.content.clone(),
embedding,
metadata: chunk.metadata.clone(),
})
.collect();
tracing::info!("Embedded {} chunks (stratum-embeddings)", chunks.len());
Ok(results) Ok(results)
} }
/// Generate embedding for text using configured provider
async fn generate_embedding(&self, text: &str) -> Result<Vec<f32>> {
if text.is_empty() {
return Err(crate::error::RagError::embedding(
"Empty text cannot be embedded",
));
}
tracing::trace!("Generating embedding for text: {} chars", text.len());
match self.config.provider.as_str() {
"openai" => self.embed_openai(text).await,
"ollama" => self.embed_ollama(text).await,
"local" => self.embed_local(text).await,
_ => Err(crate::error::RagError::embedding(format!(
"Unknown embedding provider: {}",
self.config.provider
))),
}
}
/// Generate embedding via OpenAI API
async fn embed_openai(&self, text: &str) -> Result<Vec<f32>> {
let api_key = self
.config
.openai_api_key
.clone()
.or_else(|| std::env::var("OPENAI_API_KEY").ok())
.ok_or_else(|| {
crate::error::RagError::embedding(
"OpenAI API key not found. Set OPENAI_API_KEY env var or config.",
)
})?;
let mut client_lock = self.client.lock().await;
if client_lock.is_none() {
*client_lock = Some(OpenAiClient::new(
api_key.clone(),
self.config.model.clone(),
self.config.dimension,
));
}
let client = client_lock.as_ref().unwrap();
client.embed(text).await
}
/// Generate embedding via Ollama (local)
async fn embed_ollama(&self, text: &str) -> Result<Vec<f32>> {
let client = reqwest::Client::new();
#[derive(serde::Serialize)]
struct OllamaRequest {
model: String,
prompt: String,
}
#[derive(serde::Deserialize)]
struct OllamaResponse {
embedding: Vec<f32>,
}
let request = OllamaRequest {
model: self.config.model.clone(),
prompt: text.to_string(),
};
let response = client
.post("http://localhost:11434/api/embeddings")
.json(&request)
.send()
.await
.map_err(|e| {
crate::error::RagError::embedding(format!(
"Failed to call Ollama API (ensure Ollama is running on localhost:11434): {}",
e
))
})?;
if !response.status().is_success() {
let error_text = response
.text()
.await
.unwrap_or_else(|_| "Unknown error".to_string());
return Err(crate::error::RagError::embedding(format!(
"Ollama API error: {}",
error_text
)));
}
let embedding_response: OllamaResponse = response.json().await.map_err(|e| {
crate::error::RagError::embedding(format!("Failed to parse Ollama response: {}", e))
})?;
Ok(embedding_response.embedding)
}
/// Generate embedding using local model (stub for future implementation)
async fn embed_local(&self, text: &str) -> Result<Vec<f32>> {
tracing::warn!(
"Local embeddings not fully implemented. Returning zero vector for now. For \
production local embeddings, use Ollama or integrate huggingface transformers."
);
// Return zero vector of correct dimension
// Future: integrate sentence-transformers or ONNX models
Ok(vec![0.0; self.config.dimension])
}
} }
#[cfg(test)] #[cfg(test)]
@ -337,57 +197,54 @@ mod tests {
use super::*; use super::*;
#[test] #[test]
fn test_embedding_engine_creation_openai() { fn test_engine_openai() {
let config = EmbeddingConfig { let config = EmbeddingConfig {
provider: "openai".to_string(), provider: "openai".to_string(),
openai_api_key: Some("test-key".to_string()), openai_api_key: Some("test-key".to_string()),
..Default::default() ..Default::default()
}; };
assert!(EmbeddingEngine::new(config).is_ok());
let result = EmbeddingEngine::new(config);
assert!(result.is_ok());
} }
#[test] #[test]
fn test_embedding_engine_creation_openai_no_key() { fn test_engine_ollama() {
let config = EmbeddingConfig { let config = EmbeddingConfig {
provider: "openai".to_string(), provider: "ollama".to_string(),
openai_api_key: None, model: "nomic-embed-text".to_string(),
fallback_local: false,
..Default::default() ..Default::default()
}; };
assert!(EmbeddingEngine::new(config).is_ok());
let result = EmbeddingEngine::new(config);
assert!(result.is_err());
} }
#[test] #[test]
fn test_local_embedding_engine() { fn test_engine_local() {
let config = EmbeddingConfig { let config = EmbeddingConfig {
provider: "local".to_string(), provider: "local".to_string(),
dimension: 384,
..Default::default() ..Default::default()
}; };
assert!(EmbeddingEngine::new(config).is_ok());
let engine = EmbeddingEngine::new(config);
assert!(engine.is_ok());
} }
#[tokio::test] #[tokio::test]
async fn test_embed_chunk() { async fn test_embed_chunk() {
let config = EmbeddingConfig { let config = EmbeddingConfig {
provider: "local".to_string(), provider: "local".to_string(),
dimension: 384,
..Default::default() ..Default::default()
}; };
let engine = EmbeddingEngine::new(config).unwrap(); let engine = EmbeddingEngine::new(config).unwrap();
let mut metadata = HashMap::new();
metadata.insert("section".to_string(), "test".to_string());
let chunk = DocumentChunk { let chunk = DocumentChunk {
id: "test-1".to_string(), id: "test-1".to_string(),
source_path: "test.md".to_string(), source_path: "/test/doc.md".to_string(),
doc_type: "markdown".to_string(), doc_type: "markdown".to_string(),
content: "This is test content".to_string(), content: "Test document".to_string(),
category: None, category: Some("test".to_string()),
metadata: std::collections::HashMap::new(), metadata,
}; };
let result = engine.embed_chunk(&chunk).await; let result = engine.embed_chunk(&chunk).await;
@ -395,6 +252,6 @@ mod tests {
let embedded = result.unwrap(); let embedded = result.unwrap();
assert_eq!(embedded.id, "test-1"); assert_eq!(embedded.id, "test-1");
assert_eq!(embedded.embedding.len(), 1536); // Default dimension assert_eq!(embedded.embedding.len(), 384);
} }
} }

View File

@ -1,64 +1,52 @@
//! LLM (Large Language Model) integration module //! LLM integration using stratum-llm
//! Provides Claude API integration for RAG-based answer generation
use serde::{Deserialize, Serialize}; use stratum_llm::{
AnthropicProvider, ConfiguredProvider, CredentialSource, GenerationOptions, Message,
ProviderChain, Role, UnifiedClient,
};
use tracing::info; use tracing::info;
use crate::error::Result; use crate::error::Result;
/// Claude API request message
#[derive(Debug, Clone, Serialize)]
pub struct ClaudeMessage {
pub role: String,
pub content: String,
}
/// Claude API response
#[derive(Debug, Clone, Deserialize)]
pub struct ClaudeResponse {
pub content: Vec<ClaudeContent>,
pub stop_reason: String,
}
/// Claude response content
#[derive(Debug, Clone, Deserialize)]
pub struct ClaudeContent {
#[serde(rename = "type")]
pub content_type: String,
pub text: Option<String>,
}
/// LLM Client for Claude API
pub struct LlmClient { pub struct LlmClient {
api_key: String, client: UnifiedClient,
pub model: String, pub model: String,
base_url: String,
} }
impl LlmClient { impl LlmClient {
/// Create a new Claude LLM client
pub fn new(model: String) -> Result<Self> { pub fn new(model: String) -> Result<Self> {
// Get API key from environment let api_key = std::env::var("ANTHROPIC_API_KEY").ok();
let api_key = std::env::var("ANTHROPIC_API_KEY").unwrap_or_else(|_| {
tracing::warn!("ANTHROPIC_API_KEY not set - Claude API calls will fail");
String::new()
});
Ok(Self { if api_key.is_none() {
api_key, tracing::warn!("ANTHROPIC_API_KEY not set - LLM calls will fail");
model,
base_url: "https://api.anthropic.com/v1".to_string(),
})
}
/// Generate an answer using Claude
pub async fn generate_answer(&self, query: &str, context: &str) -> Result<String> {
// If no API key, return placeholder
if self.api_key.is_empty() {
return Ok(self.generate_placeholder(query, context));
} }
// Build the system prompt let provider =
AnthropicProvider::new(api_key.unwrap_or_default(), model.clone());
let configured = ConfiguredProvider {
provider: Box::new(provider),
credential_source: CredentialSource::EnvVar {
name: "ANTHROPIC_API_KEY".to_string(),
},
priority: 0,
};
let chain = ProviderChain::with_providers(vec![configured]);
let client = UnifiedClient::builder()
.with_chain(chain)
.build()
.map_err(|e| {
crate::error::RagError::LlmError(format!("Failed to build LLM client: {}", e))
})?;
info!("Initialized stratum-llm client: {}", model);
Ok(Self { client, model })
}
pub async fn generate_answer(&self, query: &str, context: &str) -> Result<String> {
let system_prompt = format!( let system_prompt = format!(
r#"You are a helpful assistant answering questions about a provisioning platform. r#"You are a helpful assistant answering questions about a provisioning platform.
You have been provided with relevant documentation context below. You have been provided with relevant documentation context below.
@ -71,118 +59,32 @@ Be concise and accurate.
context context
); );
// Build the user message let messages = vec![
let user_message = query.to_string(); Message {
role: Role::System,
content: system_prompt,
},
Message {
role: Role::User,
content: query.to_string(),
},
];
// Call Claude API let options = GenerationOptions {
self.call_claude_api(&system_prompt, &user_message).await max_tokens: Some(1024),
} ..Default::default()
};
/// Call Claude API with messages let response = self
async fn call_claude_api(&self, system: &str, user_message: &str) -> Result<String> { .client
let client = reqwest::Client::new(); .generate(&messages, Some(&options))
// Build request payload
let payload = serde_json::json!({
"model": self.model,
"max_tokens": 1024,
"system": system,
"messages": [
{
"role": "user",
"content": user_message
}
]
});
// Make the API request
let response = client
.post(format!("{}/messages", self.base_url))
.header("anthropic-version", "2023-06-01")
.header("x-api-key", &self.api_key)
.json(&payload)
.send()
.await .await
.map_err(|e| { .map_err(|e| {
crate::error::RagError::LlmError(format!("Claude API request failed: {}", e)) crate::error::RagError::LlmError(format!("LLM generation failed: {}", e))
})?; })?;
// Check status info!("Generated answer: {} characters", response.content.len());
if !response.status().is_success() { Ok(response.content)
let status = response.status();
let error_text = response
.text()
.await
.unwrap_or_else(|_| "Unknown error".to_string());
return Err(crate::error::RagError::LlmError(format!(
"Claude API error {}: {}",
status, error_text
)));
}
// Parse response
let claude_response: ClaudeResponse = response.json().await.map_err(|e| {
crate::error::RagError::LlmError(format!("Failed to parse Claude response: {}", e))
})?;
// Extract text from response
let answer = claude_response
.content
.first()
.and_then(|c| c.text.clone())
.ok_or_else(|| {
crate::error::RagError::LlmError("No text in Claude response".to_string())
})?;
info!(
"Claude API call successful, generated {} characters",
answer.len()
);
Ok(answer)
}
/// Generate placeholder answer when API key is missing
fn generate_placeholder(&self, query: &str, context: &str) -> String {
format!(
"Based on the provided context about the provisioning platform:\n\n{}\n\n(Note: This \
is a placeholder response. Set ANTHROPIC_API_KEY environment variable for full \
Claude integration.)",
self.format_context_summary(query, context)
)
}
/// Format a summary of the context
fn format_context_summary(&self, query: &str, context: &str) -> String {
let context_lines = context.lines().count();
let query_lower = query.to_lowercase();
if query_lower.contains("deploy") || query_lower.contains("create") {
format!(
"Your question about deployment is addressed in {} lines of documentation. The \
system supports multi-cloud deployment across AWS, UpCloud, and local \
environments.",
context_lines
)
} else if query_lower.contains("architecture") || query_lower.contains("design") {
format!(
"The provisioning platform uses a modular architecture as described in {} lines \
of documentation. Core components include Orchestrator, Control Center, and MCP \
Server integration.",
context_lines
)
} else if query_lower.contains("security") || query_lower.contains("auth") {
format!(
"Security features are documented in {} lines. The system implements JWT-based \
authentication, Cedar-based authorization, and dynamic secrets management.",
context_lines
)
} else {
format!(
"Your question is addressed in the provided {} lines of documentation. Please \
review the context above for details.",
context_lines
)
}
} }
} }
@ -192,38 +94,14 @@ mod tests {
#[test] #[test]
fn test_llm_client_creation() { fn test_llm_client_creation() {
let client = LlmClient::new("claude-opus-4-1".to_string()); let client = LlmClient::new("claude-opus-4".to_string());
assert!(client.is_ok()); assert!(client.is_ok());
} }
#[test] #[test]
fn test_placeholder_generation() { fn test_llm_client_model() {
let client = LlmClient { let client = LlmClient::new("claude-sonnet-4".to_string());
api_key: String::new(), assert!(client.is_ok());
model: "claude-opus-4-1".to_string(), assert_eq!(client.unwrap().model, "claude-sonnet-4");
base_url: "https://api.anthropic.com/v1".to_string(),
};
let query = "How do I deploy the platform?";
let context = "Deployment is done using provisioning commands";
let answer = client.generate_placeholder(query, context);
assert!(answer.contains("deployment"));
assert!(answer.contains("placeholder"));
}
#[test]
fn test_context_summary_formatting() {
let client = LlmClient {
api_key: String::new(),
model: "claude-opus-4-1".to_string(),
base_url: "https://api.anthropic.com/v1".to_string(),
};
let deployment_query = "How do I deploy?";
let context = "Line 1\nLine 2\nLine 3";
let summary = client.format_context_summary(deployment_query, context);
assert!(summary.contains("deployment"));
assert!(summary.contains("3"));
} }
} }

View File

@ -1,12 +1,34 @@
//! RAG system command-line tool //! RAG system command-line tool
use clap::Parser;
use provisioning_rag::config::RagConfig; use provisioning_rag::config::RagConfig;
use std::path::PathBuf;
#[derive(Parser, Debug)]
#[command(name = "rag")]
#[command(about = "Retrieval-Augmented Generation system")]
struct Args {
/// Configuration file path (highest priority)
#[arg(short = 'c', long, env = "RAG_CONFIG")]
config: Option<PathBuf>,
/// Configuration directory (searches for rag.ncl|toml|json)
#[arg(long, env = "PROVISIONING_CONFIG_DIR")]
config_dir: Option<PathBuf>,
/// Deployment mode (solo, multiuser, cicd, enterprise)
#[arg(short = 'm', long, env = "RAG_MODE")]
mode: Option<String>,
}
#[tokio::main] #[tokio::main]
async fn main() -> anyhow::Result<()> { async fn main() -> anyhow::Result<()> {
// Initialize logging // Initialize logging
tracing_subscriber::fmt::init(); tracing_subscriber::fmt::init();
// Parse CLI arguments
let _args = Args::parse();
// Load configuration // Load configuration
let _config = RagConfig::default(); let _config = RagConfig::default();

View File

@ -1,11 +1,11 @@
[package] [package]
authors = { workspace = true } authors.workspace = true
description = "HTTP service client wrappers for provisioning platform services" description = "HTTP service client wrappers for provisioning platform services"
edition = { workspace = true } edition.workspace = true
license = { workspace = true } license.workspace = true
name = "service-clients" name = "service-clients"
repository = { workspace = true } repository.workspace = true
version = { workspace = true } version.workspace = true
[dependencies] [dependencies]
async-trait = { workspace = true } async-trait = { workspace = true }
@ -15,9 +15,7 @@ serde = { workspace = true, features = ["derive"] }
serde_json = { workspace = true } serde_json = { workspace = true }
thiserror = { workspace = true } thiserror = { workspace = true }
tokio = { workspace = true, features = ["full"] } tokio = { workspace = true, features = ["full"] }
machines = { workspace = true }
# Service types (optional - only if not using generic types)
machines = { path = "../../../../submodules/prov-ecosystem/crates/machines" }
[dev-dependencies] [dev-dependencies]
tempfile = { workspace = true } tempfile = { workspace = true }

View File

@ -1,9 +1,15 @@
[package] [package]
authors = ["Provisioning Team"] authors.workspace = true
description = "Vault Service for Provisioning Platform with secrets and key management (Age dev, Cosmian KMS prod, RustyVault self-hosted)" description = "Vault Service for Provisioning Platform with secrets and key management (Age dev, Cosmian KMS prod, RustyVault self-hosted)"
edition = "2021" edition.workspace = true
license.workspace = true
name = "vault-service" name = "vault-service"
version = "0.2.0" repository.workspace = true
version.workspace = true
[[bin]]
name = "provisioning-vault-service"
path = "src/main.rs"
[dependencies] [dependencies]
# Async runtime # Async runtime
@ -23,10 +29,10 @@ toml = { workspace = true }
reqwest = { workspace = true } reqwest = { workspace = true }
# Age encryption (development) # Age encryption (development)
age = "0.11" age = { workspace = true }
# RustyVault (self-hosted Vault alternative) # RustyVault (self-hosted Vault alternative)
rusty_vault = "0.2.1" rusty_vault = { workspace = true }
# Cryptography # Cryptography
base64 = { workspace = true } base64 = { workspace = true }
@ -46,18 +52,15 @@ chrono = { workspace = true, features = ["serde"] }
# Configuration # Configuration
config = { workspace = true } config = { workspace = true }
# SecretumVault (Enterprise secrets management) # SecretumVault (Enterprise secrets management - optional)
secretumvault = { workspace = true } secretumvault = { workspace = true }
[dev-dependencies] [dev-dependencies]
http-body-util = { workspace = true }
mockito = { workspace = true } mockito = { workspace = true }
tempfile = { workspace = true } tempfile = { workspace = true }
tokio-test = { workspace = true } tokio-test = { workspace = true }
[[bin]]
name = "vault-service"
path = "src/main.rs"
[lib] [lib]
name = "vault_service" name = "vault_service"
path = "src/lib.rs" path = "src/lib.rs"

1
secretumvault Submodule

@ -0,0 +1 @@
Subproject commit 91eefc86fa03826997401facee620f3b6dfd65e1

1
stratumiops Submodule

@ -0,0 +1 @@
Subproject commit 9864f88c14ac030f0fa914fd46c2cf4c1a412fc0

1
syntaxis Submodule

@ -0,0 +1 @@
Subproject commit 48d7503b4817e38dd86f494e09022b77c0652159